 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC([n+]2cc(ccc2)C(=O)[O-])C([O-])C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C11H14NO9P/c13-8-7(5-20-22(17,18)19)21-10(9(8)14)12-3-1-2-6(4-12)11(15)16/h1-4,7-10,13H,5H2,(H,15,16)(H2,17,18,19)/p-3/t7-,8-,9-,10-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=26.3316 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 332.181 g/mol | logS: 0.20706 | SlogP: -4.7344 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0578307 | Sterimol/B1: 2.59887 | Sterimol/B2: 2.98212 | Sterimol/B3: 3.34623 | |||
| Sterimol/B4: 7.40252 | Sterimol/L: 14.8078 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 489.528 | Positive charged surface: 204.742 | Negative charged surface: 284.786 | Volume: 248.375 | |||
| Hydrophobic surface: 170.408 | Hydrophilic surface: 319.12 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 6 | Basic groups: 1 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
