Type: Ionized
Formula: C8H14NO7-
SMILES: |
OC(C(NC(=O)C)C(=O)[O-])C(O)C(O)CO |
InChI: |
InChI=1/C8H15NO7/c1-3(11)9-5(8(15)16)7(14)6(13)4(12)2-10/h4-7,10,12-14H,2H2,1H3,(H,9,11)(H,15,16)/p-1/t4-,5-,6-,7-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 236.2 g/mol | logS: 0.7834 | SlogP: -4.684 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0834899 | Sterimol/B1: 2.22477 | Sterimol/B2: 3.13352 | Sterimol/B3: 3.34356 |
Sterimol/B4: 7.0027 | Sterimol/L: 12.6224 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 420.779 | Positive charged surface: 249.275 | Negative charged surface: 171.504 | Volume: 196.125 |
Hydrophobic surface: 172.509 | Hydrophilic surface: 248.27 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|