Type: Neutral
Formula: C17H22N2
SMILES: |
n1c2c(CCCC2)c(NCCCC)c2c1cccc2 |
InChI: |
InChI=1/C17H22N2/c1-2-3-12-18-17-13-8-4-6-10-15(13)19-16-11-7-5-9-14(16)17/h4,6,8,10H,2-3,5,7,9,11-12H2,1H3,(H,18,19) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 254.377 g/mol | logS: -3.90289 | SlogP: 4.32554 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0702072 | Sterimol/B1: 2.69886 | Sterimol/B2: 3.31694 | Sterimol/B3: 4.57212 |
Sterimol/B4: 7.74674 | Sterimol/L: 13.6761 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 515.498 | Positive charged surface: 367.324 | Negative charged surface: 144.022 | Volume: 275.375 |
Hydrophobic surface: 459.335 | Hydrophilic surface: 56.163 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |