 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OC1CC(OC1CO)N1C=C(C)C(=O)NC1=O)(=O)([O-])[O-] |
| InChI: | InChI=1/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(7(4-13)19-8)20-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/p-2/t6-,7-,8+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-20.1572 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 320.194 g/mol | logS: -0.22353 | SlogP: -3.307 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0989065 | Sterimol/B1: 2.75278 | Sterimol/B2: 3.37114 | Sterimol/B3: 3.86375 | |||
| Sterimol/B4: 5.9459 | Sterimol/L: 13.9373 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 490.424 | Positive charged surface: 252.067 | Negative charged surface: 238.358 | Volume: 246.25 | |||
| Hydrophobic surface: 204.793 | Hydrophilic surface: 285.631 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
