 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OC1CC(OC1CO)N1C=C(C)C(=O)NC1=O)(=O)([O-])[O-] |
| InChI: | InChI=1/C10H15N2O8P/c1-5-3-12(10(15)11-9(5)14)8-2-6(7(4-13)19-8)20-21(16,17)18/h3,6-8,13H,2,4H2,1H3,(H,11,14,15)(H2,16,17,18)/p-2/t6-,7-,8-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-23.6318 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 320.194 g/mol | logS: -0.22353 | SlogP: -3.307 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.272069 | Sterimol/B1: 2.58751 | Sterimol/B2: 4.26233 | Sterimol/B3: 5.51914 | |||
| Sterimol/B4: 7.17467 | Sterimol/L: 12.2314 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 473.737 | Positive charged surface: 243.629 | Negative charged surface: 230.107 | Volume: 245.875 | |||
| Hydrophobic surface: 197.12 | Hydrophilic surface: 276.617 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
