Type: Neutral
Formula: C9H15N3O6
SMILES: |
O1C(CO)C(O)C(O)C1[N+]1=C[NH2+][C-](C(=O)N)C1[O-] |
InChI: |
InChI=1/C9H15N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,8-9,13-15H,1,11H2,(H2,10,16)/t3-,5+,6-,8-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 261.234 g/mol | logS: 0.67737 | SlogP: -5.18291 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.154295 | Sterimol/B1: 2.24326 | Sterimol/B2: 2.90503 | Sterimol/B3: 4.99315 |
Sterimol/B4: 5.58362 | Sterimol/L: 12.1435 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 434.091 | Positive charged surface: 322.298 | Negative charged surface: 111.793 | Volume: 213.625 |
Hydrophobic surface: 115.344 | Hydrophilic surface: 318.747 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 1 | Basic groups: 1 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |