 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C1N(CCC1)C(=O)C(NC(CCc1ccccc1)C(O)=O)CCCCN |
| InChI: | InChI=1/C21H31N3O5/c22-13-5-4-9-16(19(25)24-14-6-10-18(24)21(28)29)23-17(20(26)27)12-11-15-7-2-1-3-8-15/h1-3,7-8,16-18,23H,4-6,9-14,22H2,(H,26,27)(H,28,29)/t16-,17+,18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=99.3555 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.495 g/mol | logS: -2.29593 | SlogP: 1.23517 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.143422 | Sterimol/B1: 3.05946 | Sterimol/B2: 3.68183 | Sterimol/B3: 6.77476 | |||
| Sterimol/B4: 8.56937 | Sterimol/L: 17.7293 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 700.575 | Positive charged surface: 478.028 | Negative charged surface: 222.546 | Volume: 397.75 | |||
| Hydrophobic surface: 443.321 | Hydrophilic surface: 257.254 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
