 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | SCC(NC(=O)CCCC([NH3+])C(=O)[O-])C(=O)NC(C(C)C)C(=O)[O-] |
| InChI: | InChI=1/C14H25N3O6S/c1-7(2)11(14(22)23)17-12(19)9(6-24)16-10(18)5-3-4-8(15)13(20)21/h7-9,11,24H,3-6,15H2,1-2H3,(H,16,18)(H,17,19)(H,20,21)(H,22,23)/p-1/t8-,9-,11-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=44.6524 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 362.427 g/mol | logS: -2.1199 | SlogP: -4.1776 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0407205 | Sterimol/B1: 1.97529 | Sterimol/B2: 3.39289 | Sterimol/B3: 4.83714 | |||
| Sterimol/B4: 7.41118 | Sterimol/L: 18.9541 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 628.996 | Positive charged surface: 369.432 | Negative charged surface: 259.564 | Volume: 326.375 | |||
| Hydrophobic surface: 261.05 | Hydrophilic surface: 367.946 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
