 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(=O)[O-])C1(C)C)C(=O)C2NC(=O)C(C(Oc1cc2CCCc2cc1)=O) c1ccccc1 |
| InChI: | InChI=1/C26H26N2O6S/c1-26(2)20(24(31)32)28-22(30)19(23(28)35-26)27-21(29)18(15-7-4-3-5-8-15)25(33)34-17-12-11-14-9-6-10-16(14)13-17/h3-5,7-8,11-13,18-20,23H,6,9-10H2,1-2H3,(H,27,29)(H,31,32)/p-1/t18-,19-,20+,23-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=117.874 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 493.56 g/mol | logS: -7.11614 | SlogP: 1.16144 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0663711 | Sterimol/B1: 3.93425 | Sterimol/B2: 5.01136 | Sterimol/B3: 6.14496 | |||
| Sterimol/B4: 6.3532 | Sterimol/L: 20.6349 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 762.431 | Positive charged surface: 413.505 | Negative charged surface: 318.385 | Volume: 453 | |||
| Hydrophobic surface: 545.849 | Hydrophilic surface: 216.582 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
