 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C(O)C(O)CN)C(NC(=O)C)C(O)CC1(OC)C(O)=O |
| InChI: | InChI=1/C12H22N2O8/c1-5(15)14-8-6(16)3-12(21-2,11(19)20)22-10(8)9(18)7(17)4-13/h6-10,16-18H,3-4,13H2,1-2H3,(H,14,15)(H,19,20)/t6-,7+,8+,9+,10-,12+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=101.212 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 322.314 g/mol | logS: 0.4581 | SlogP: -3.2513 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.294456 | Sterimol/B1: 2.26764 | Sterimol/B2: 3.87617 | Sterimol/B3: 5.09863 | |||
| Sterimol/B4: 9.08939 | Sterimol/L: 11.8832 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 520.226 | Positive charged surface: 377.13 | Negative charged surface: 143.096 | Volume: 280.25 | |||
| Hydrophobic surface: 238.092 | Hydrophilic surface: 282.134 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 7 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules: no related molecules available.