Type: Neutral
Formula: C9H13N5O3
SMILES: |
O=C1N=C(NC2=NCC(N=C12)C(O)C(O)C)N |
InChI: |
InChI=1/C9H13N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h3-4,6,15-16H,2H2,1H3,(H3,10,11,13,14,17)/t3-,4-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 239.235 g/mol | logS: -1.32041 | SlogP: -2.6057 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0754965 | Sterimol/B1: 3.27365 | Sterimol/B2: 3.76476 | Sterimol/B3: 3.89885 |
Sterimol/B4: 4.95332 | Sterimol/L: 13.6567 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 430.181 | Positive charged surface: 301.586 | Negative charged surface: 128.596 | Volume: 205.375 |
Hydrophobic surface: 129.391 | Hydrophilic surface: 300.79 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |