 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C=C(F)C(=O)NC2=O)CC1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C9H12FN2O8P/c10-4-2-12(9(15)11-8(4)14)7-1-5(13)6(20-7)3-19-21(16,17)18/h2,5-7,13H,1,3H2,(H,11,14,15)(H2,16,17,18)/p-2/t5-,6-,7-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-3.07275 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 324.157 g/mol | logS: -0.59582 | SlogP: -3.291 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0917403 | Sterimol/B1: 3.52596 | Sterimol/B2: 3.70757 | Sterimol/B3: 3.8743 | |||
| Sterimol/B4: 5.67307 | Sterimol/L: 14.316 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 467.738 | Positive charged surface: 200.602 | Negative charged surface: 267.136 | Volume: 230 | |||
| Hydrophobic surface: 175.038 | Hydrophilic surface: 292.7 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
