 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C=C(C)C(=O)NC2=O)CC1N=[N+]=[N-])(=O)([O-])[O-] |
| InChI: | InChI=1/C10H14N5O7P/c1-5-3-15(10(17)12-9(5)16)8-2-6(13-14-11)7(22-8)4-21-23(18,19)20/h3,6-8H,2,4H2,1H3,(H,12,16,17)(H2,18,19,20)/p-2/t6-,7+,8+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-23.6138 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 345.208 g/mol | logS: -0.59219 | SlogP: -1.989 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0730417 | Sterimol/B1: 2.81269 | Sterimol/B2: 3.22176 | Sterimol/B3: 3.69532 | |||
| Sterimol/B4: 8.98503 | Sterimol/L: 13.2709 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 521.075 | Positive charged surface: 217.905 | Negative charged surface: 303.17 | Volume: 264.625 | |||
| Hydrophobic surface: 176.938 | Hydrophilic surface: 344.137 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
