Type: Neutral
Formula: C11H14N4O4
SMILES: |
O1C(CO)C(O)C(O)C1n1c2nccc(N)c2nc1 |
InChI: |
InChI=1/C11H14N4O4/c12-5-1-2-13-10-7(5)14-4-15(10)11-9(18)8(17)6(3-16)19-11/h1-2,4,6,8-9,11,16-18H,3H2,(H2,12,13)/t6-,8+,9-,11+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 266.257 g/mol | logS: -0.96298 | SlogP: -1.2795 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0707836 | Sterimol/B1: 3.24766 | Sterimol/B2: 3.46527 | Sterimol/B3: 3.5708 |
Sterimol/B4: 4.4411 | Sterimol/L: 13.1362 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 449.243 | Positive charged surface: 347.439 | Negative charged surface: 101.804 | Volume: 226.625 |
Hydrophobic surface: 218.022 | Hydrophilic surface: 231.221 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |