Type: Neutral
Formula: C17H23N3O2
SMILES: |
O=C1NC(Cc2c3c(N(C)C1C(C)C)cccc3[nH]c2)CO |
InChI: |
InChI=1/C17H23N3O2/c1-10(2)16-17(22)19-12(9-21)7-11-8-18-13-5-4-6-14(15(11)13)20(16)3/h4-6,8,10,12,16,18,21H,7,9H2,1-3H3,(H,19,22)/t12-,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 301.39 g/mol | logS: -2.48684 | SlogP: 1.66187 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.270492 | Sterimol/B1: 2.99328 | Sterimol/B2: 4.9738 | Sterimol/B3: 5.32475 |
Sterimol/B4: 6.18584 | Sterimol/L: 11.7748 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 501.438 | Positive charged surface: 352.607 | Negative charged surface: 146.952 | Volume: 297 |
Hydrophobic surface: 332.263 | Hydrophilic surface: 169.175 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |