Type: Neutral
Formula: C16H25N3O7S2
SMILES: |
S(=O)(=O)(N1CC(NS(=O)(=O)C)CC1C(=O)NO)c1ccc(OCCCC)cc1 |
InChI: |
InChI=1/C16H25N3O7S2/c1-3-4-9-26-13-5-7-14(8-6-13)28(24,25)19-11-12(18-27(2,22)23)10-15(19)16(20)17-21/h5-8,12,15,18,21H,3-4,9-11H2,1-2H3,(H,17,20)/t12-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 435.522 g/mol | logS: -2.63404 | SlogP: 0.0517 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0675634 | Sterimol/B1: 3.07009 | Sterimol/B2: 4.94866 | Sterimol/B3: 5.76512 |
Sterimol/B4: 7.62609 | Sterimol/L: 19.5746 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 690.593 | Positive charged surface: 401.631 | Negative charged surface: 288.962 | Volume: 368.375 |
Hydrophobic surface: 413.917 | Hydrophilic surface: 276.676 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |