 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3NC(=O)NC(=O)c3nc2)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C10H13N4O9P/c15-5-3(1-22-24(19,20)21)23-9(6(5)16)14-2-11-4-7(14)12-10(18)13-8(4)17/h2-3,5-6,9,15-16H,1H2,(H2,19,20,21)(H2,12,13,17,18)/p-2/t3-,5+,6+,9-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-3.36291 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 362.191 g/mol | logS: -0.39552 | SlogP: -4.3518 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0835501 | Sterimol/B1: 2.32433 | Sterimol/B2: 3.30715 | Sterimol/B3: 3.7446 | |||
| Sterimol/B4: 5.83238 | Sterimol/L: 15.48 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 480.56 | Positive charged surface: 246.269 | Negative charged surface: 234.291 | Volume: 256.5 | |||
| Hydrophobic surface: 139.568 | Hydrophilic surface: 340.992 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
