 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(C2=CNC(=O)NC2=O)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C9H13N2O9P/c12-5-4(2-19-21(16,17)18)20-7(6(5)13)3-1-10-9(15)11-8(3)14/h1,4-7,12-13H,2H2,(H2,16,17,18)(H2,10,11,14,15)/p-2/t4-,5+,6+,7-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=4.10733 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 322.166 g/mol | logS: -0.03712 | SlogP: -5.026 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.137816 | Sterimol/B1: 2.49338 | Sterimol/B2: 4.7737 | Sterimol/B3: 5.01462 | |||
| Sterimol/B4: 5.14076 | Sterimol/L: 14.7968 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 480.521 | Positive charged surface: 225.059 | Negative charged surface: 255.462 | Volume: 231.875 | |||
| Hydrophobic surface: 112.769 | Hydrophilic surface: 367.752 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
