 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(NCCCCC([NH3+])C(=O)[O-])C(=O)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C12H23N2O10P/c13-6(12(18)19)3-1-2-4-14-11-10(17)9(16)8(15)7(24-11)5-23-25(20,21)22/h6-9,11,14-16H,1-5,13H2,(H,18,19)(H2,20,21,22)/p-2/t6-,7-,8+,9-,11+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=33.773 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 384.278 g/mol | logS: 0.28739 | SlogP: -7.1024 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0656157 | Sterimol/B1: 3.45551 | Sterimol/B2: 3.76289 | Sterimol/B3: 5.14627 | |||
| Sterimol/B4: 6.67158 | Sterimol/L: 16.1551 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 597.4 | Positive charged surface: 337.947 | Negative charged surface: 259.453 | Volume: 308.125 | |||
| Hydrophobic surface: 193.207 | Hydrophilic surface: 404.193 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 5 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
