Type: Ionized
Formula: C7H7O7-3
SMILES: |
OC(C(C(=O)[O-])C)(CC(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C7H10O7/c1-3(5(10)11)7(14,6(12)13)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-3/t3-,7-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 203.126 g/mol | logS: -0.12248 | SlogP: -5.0066 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.260898 | Sterimol/B1: 2.27407 | Sterimol/B2: 3.27731 | Sterimol/B3: 3.40986 |
Sterimol/B4: 5.89851 | Sterimol/L: 10.0994 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 341.641 | Positive charged surface: 123.953 | Negative charged surface: 217.688 | Volume: 155.5 |
Hydrophobic surface: 79.3152 | Hydrophilic surface: 262.3258 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 6 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|