 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(NC=2NC(=O)NC(=O)C=2N)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C9H15N4O9P/c10-3-6(12-9(17)13-7(3)16)11-8-5(15)4(14)2(22-8)1-21-23(18,19)20/h2,4-5,8,14-15H,1,10H2,(H2,18,19,20)(H3,11,12,13,16,17)/p-2/t2-,4-,5+,8-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=11.613 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 352.196 g/mol | logS: 0.21313 | SlogP: -6.235 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.106438 | Sterimol/B1: 3.14198 | Sterimol/B2: 4.22646 | Sterimol/B3: 4.4674 | |||
| Sterimol/B4: 4.64544 | Sterimol/L: 15.3117 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 525.748 | Positive charged surface: 271.428 | Negative charged surface: 254.32 | Volume: 256.75 | |||
| Hydrophobic surface: 94.0429 | Hydrophilic surface: 431.7051 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | ||||
|
