 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(NC(=O)CNC=O)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C8H15N2O9P/c11-3-9-1-5(12)10-8-7(14)6(13)4(19-8)2-18-20(15,16)17/h3-4,6-8,13-14H,1-2H2,(H,9,11)(H,10,12)(H2,15,16,17)/p-2/t4-,6+,7+,8-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-4.88069 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 312.171 g/mol | logS: 0.67283 | SlogP: -5.9296 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0809863 | Sterimol/B1: 3.02615 | Sterimol/B2: 3.10155 | Sterimol/B3: 3.76478 | |||
| Sterimol/B4: 5.44285 | Sterimol/L: 15.4794 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 477.521 | Positive charged surface: 264.885 | Negative charged surface: 212.635 | Volume: 230.875 | |||
| Hydrophobic surface: 152.86 | Hydrophilic surface: 324.661 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
