 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S=C1NC(=O)C(=CN1C1OC(CO)C(O)C1O)CNC |
| InChI: | InChI=1/C11H17N3O5S/c1-12-2-5-3-14(11(20)13-9(5)18)10-8(17)7(16)6(4-15)19-10/h3,6-8,10,12,15-17H,2,4H2,1H3,(H,13,18,20)/t6-,7+,8-,10+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=93.1092 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 303.339 g/mol | logS: -1.12008 | SlogP: -2.7546 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.134061 | Sterimol/B1: 2.70867 | Sterimol/B2: 3.43067 | Sterimol/B3: 3.92679 | |||
| Sterimol/B4: 8.20829 | Sterimol/L: 12.2939 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 491.381 | Positive charged surface: 346.808 | Negative charged surface: 144.572 | Volume: 257 | |||
| Hydrophobic surface: 208.614 | Hydrophilic surface: 282.767 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
