Type: Ionized
Formula: C3H3O10P2-5
SMILES: |
P(OC(C(=O)[O-])COP(=O)([O-])[O-])(=O)([O-])[O-] |
InChI: |
InChI=1/C3H8O10P2/c4-3(5)2(13-15(9,10)11)1-12-14(6,7)8/h2H,1H2,(H,4,5)(H2,6,7,8)(H2,9,10,11)/p-5/t2-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 260.995 g/mol | logS: 0.69701 | SlogP: -7.3449 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.145356 | Sterimol/B1: 2.34014 | Sterimol/B2: 3.66479 | Sterimol/B3: 3.98854 |
Sterimol/B4: 4.70404 | Sterimol/L: 11.186 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 380.93 | Positive charged surface: 67.6834 | Negative charged surface: 313.246 | Volume: 156 |
Hydrophobic surface: 34.5113 | Hydrophilic surface: 346.4187 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 2 | Acid groups: 8 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|