Type: Neutral
Formula: C9H17N5O8
| SMILES: |
OC1(N(O)C2C(N=C(NC2=O)N)N(O)C1O)C(O)C(O)CO |
| InChI: |
InChI=1/C9H17N5O8/c10-8-11-5-3(6(18)12-8)14(22)9(20,7(19)13(5)21)4(17)2(16)1-15/h2-5,7,15-17,19-22H,1H2,(H3,10,11,12,18)/t2-,3+,4-,5+,7-,9-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 323.262 g/mol | logS: 1.56454 | SlogP: -5.7573 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.098183 | Sterimol/B1: 3.21109 | Sterimol/B2: 3.73196 | Sterimol/B3: 4.13161 |
| Sterimol/B4: 5.48071 | Sterimol/L: 14.7525 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 475.433 | Positive charged surface: 342.932 | Negative charged surface: 132.501 | Volume: 250 |
| Hydrophobic surface: 86.9501 | Hydrophilic surface: 388.4829 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 9 | Hydrogen bond acceptors: 11 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 6 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 0 | Violations of Lipinski's rule: 2 | Oprea's lead like rule: 0 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |