Type: Neutral
Formula: C10H14N2O5
SMILES: |
O1C(N2C=C(C)C(=O)NC2=O)C(O)CC1CO |
InChI: |
InChI=1/C10H14N2O5/c1-5-3-12(10(16)11-8(5)15)9-7(14)2-6(4-13)17-9/h3,6-7,9,13-14H,2,4H2,1H3,(H,11,15,16)/t6-,7-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 242.231 g/mol | logS: -0.29291 | SlogP: -1.0898 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.161598 | Sterimol/B1: 2.50223 | Sterimol/B2: 3.74207 | Sterimol/B3: 3.89856 |
Sterimol/B4: 4.67955 | Sterimol/L: 12.8502 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 430.82 | Positive charged surface: 305.949 | Negative charged surface: 124.871 | Volume: 210.125 |
Hydrophobic surface: 233.723 | Hydrophilic surface: 197.097 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |