Type: Neutral
Formula: C11H12N2O6
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(C#C)C(=O)NC1=O |
InChI: |
InChI=1/C11H12N2O6/c1-2-5-3-13(11(18)12-9(5)17)10-8(16)7(15)6(4-14)19-10/h1,3,6-8,10,14-16H,4H2,(H,12,17,18)/t6-,7-,8+,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.225 g/mol | logS: -0.79989 | SlogP: -2.50569 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.129211 | Sterimol/B1: 2.8917 | Sterimol/B2: 2.98266 | Sterimol/B3: 4.96495 |
Sterimol/B4: 5.37275 | Sterimol/L: 13.9414 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 461.611 | Positive charged surface: 275.832 | Negative charged surface: 185.779 | Volume: 225.25 |
Hydrophobic surface: 221.149 | Hydrophilic surface: 240.462 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |