Type: Neutral
Formula: C11H20NO5P
SMILES: |
P(O)(O)(=O)CC1CC2CC(NCC2CC1)C(O)=O |
InChI: |
InChI=1/C11H20NO5P/c13-11(14)10-4-9-3-7(6-18(15,16)17)1-2-8(9)5-12-10/h7-10,12H,1-6H2,(H,13,14)(H2,15,16,17)/t7-,8-,9+,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 277.257 g/mol | logS: -0.01755 | SlogP: -0.4271 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.115594 | Sterimol/B1: 2.7927 | Sterimol/B2: 3.41159 | Sterimol/B3: 3.88421 |
Sterimol/B4: 5.23914 | Sterimol/L: 14.2065 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 457.723 | Positive charged surface: 305.825 | Negative charged surface: 151.898 | Volume: 239.375 |
Hydrophobic surface: 214.174 | Hydrophilic surface: 243.549 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |