Type: Neutral
Formula: C20H23NO3
SMILES: |
O(C)c1ccc(cc1CN1CCCCC1C(O)=O)-c1ccccc1 |
InChI: |
InChI=1/C20H23NO3/c1-24-19-11-10-16(15-7-3-2-4-8-15)13-17(19)14-21-12-6-5-9-18(21)20(22)23/h2-4,7-8,10-11,13,18H,5-6,9,12,14H2,1H3,(H,22,23)/t18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 325.408 g/mol | logS: -4.48308 | SlogP: 4.0677 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.104664 | Sterimol/B1: 2.11958 | Sterimol/B2: 3.34277 | Sterimol/B3: 4.58402 |
Sterimol/B4: 8.71284 | Sterimol/L: 15.1949 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 583.44 | Positive charged surface: 390.152 | Negative charged surface: 181.9 | Volume: 325.25 |
Hydrophobic surface: 506.872 | Hydrophilic surface: 76.568 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |