Type: Neutral
Formula: C17H16F3NO2S
SMILES: |
s1cc(cc1)C(N1CCCC1C(O)=O)c1ccccc1C(F)(F)F |
InChI: |
InChI=1/C17H16F3NO2S/c18-17(19,20)13-5-2-1-4-12(13)15(11-7-9-24-10-11)21-8-3-6-14(21)16(22)23/h1-2,4-5,7,9-10,14-15H,3,6,8H2,(H,22,23)/t14-,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 355.38 g/mol | logS: -4.28275 | SlogP: 4.8123 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.272664 | Sterimol/B1: 2.88976 | Sterimol/B2: 3.63827 | Sterimol/B3: 5.77843 |
Sterimol/B4: 7.67548 | Sterimol/L: 12.1513 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 505.739 | Positive charged surface: 252.72 | Negative charged surface: 253.02 | Volume: 299.25 |
Hydrophobic surface: 368.359 | Hydrophilic surface: 137.38 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |