Type: Neutral
Formula: C16H20N2O4
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(=O)N1CCCC1C=O)C |
InChI: |
InChI=1/C16H20N2O4/c1-12(15(20)18-9-5-8-14(18)10-19)17-16(21)22-11-13-6-3-2-4-7-13/h2-4,6-7,10,12,14H,5,8-9,11H2,1H3,(H,17,21)/t12-,14+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 304.346 g/mol | logS: -2.58655 | SlogP: 1.7576 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0590866 | Sterimol/B1: 2.18568 | Sterimol/B2: 3.02359 | Sterimol/B3: 4.55213 |
Sterimol/B4: 6.88358 | Sterimol/L: 17.4927 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 578.656 | Positive charged surface: 370.808 | Negative charged surface: 207.848 | Volume: 294.5 |
Hydrophobic surface: 426.301 | Hydrophilic surface: 152.355 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |