Type: Neutral
Formula: C10H16N4O5
SMILES: |
OC(=O)C(NC(=O)C(N)C)CNC(=O)\C=C\C(=O)N |
InChI: |
InChI=1/C10H16N4O5/c1-5(11)9(17)14-6(10(18)19)4-13-8(16)3-2-7(12)15/h2-3,5-6H,4,11H2,1H3,(H2,12,15)(H,13,16)(H,14,17)(H,18,19)/b3-2+/t5-,6-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.261 g/mol | logS: -0.73447 | SlogP: -2.9393 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0492626 | Sterimol/B1: 2.26825 | Sterimol/B2: 3.29165 | Sterimol/B3: 4.47831 |
Sterimol/B4: 7.42197 | Sterimol/L: 15.1468 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 513.811 | Positive charged surface: 323.988 | Negative charged surface: 189.824 | Volume: 239.5 |
Hydrophobic surface: 160.047 | Hydrophilic surface: 353.764 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |