Type: Neutral
Formula: C21H24N4O3S
SMILES: |
S(\C(=C(\N(Cc1cnc(nc1N)C)C=O)/C)\CCO)\C=C\C(=O)c1ccccc1 |
InChI: |
InChI=1/C21H24N4O3S/c1-15(25(14-27)13-18-12-23-16(2)24-21(18)22)20(8-10-26)29-11-9-19(28)17-6-4-3-5-7-17/h3-7,9,11-12,14,26H,8,10,13H2,1-2H3,(H2,22,23,24)/b11-9+,20-15- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 412.514 g/mol | logS: -3.93595 | SlogP: 3.33572 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.130867 | Sterimol/B1: 2.41442 | Sterimol/B2: 2.79356 | Sterimol/B3: 5.8135 |
Sterimol/B4: 12.2113 | Sterimol/L: 17.4092 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 694.643 | Positive charged surface: 420.044 | Negative charged surface: 274.599 | Volume: 397.5 |
Hydrophobic surface: 463.242 | Hydrophilic surface: 231.401 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |