 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1ccc(cc1)CC(NC(=O)c1ccccc1)C(=O)NC(C(=O)[O-])C |
| InChI: | InChI=1/C20H22N2O5/c1-13(20(25)26)21-19(24)17(12-14-8-10-16(27-2)11-9-14)22-18(23)15-6-4-3-5-7-15/h3-11,13,17H,12H2,1-2H3,(H,21,24)(H,22,23)(H,25,26)/p-1/t13-,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=85.8645 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 369.397 g/mol | logS: -4.16683 | SlogP: 0.29087 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0999089 | Sterimol/B1: 3.72869 | Sterimol/B2: 3.99022 | Sterimol/B3: 5.88161 | |||
| Sterimol/B4: 6.30162 | Sterimol/L: 16.8576 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 646.165 | Positive charged surface: 387.626 | Negative charged surface: 258.539 | Volume: 355.25 | |||
| Hydrophobic surface: 474.419 | Hydrophilic surface: 171.746 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
