Type: Neutral
Formula: C16H21N3O3
SMILES: |
OC(=O)CCC(N)C(=O)NC(Cc1c2c([nH]c1)cccc2)C |
InChI: |
InChI=1/C16H21N3O3/c1-10(19-16(22)13(17)6-7-15(20)21)8-11-9-18-14-5-3-2-4-12(11)14/h2-5,9-10,13,18H,6-8,17H2,1H3,(H,19,22)(H,20,21)/t10-,13-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 303.362 g/mol | logS: -1.98048 | SlogP: 1.40717 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.155873 | Sterimol/B1: 3.01022 | Sterimol/B2: 3.37189 | Sterimol/B3: 3.87259 |
Sterimol/B4: 8.40493 | Sterimol/L: 13.0605 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 515.275 | Positive charged surface: 343.398 | Negative charged surface: 169.087 | Volume: 295 |
Hydrophobic surface: 287.879 | Hydrophilic surface: 227.396 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |