 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(Cc1ccccc1)C(=O)[O-])C(NC(=O)C)CC(C)C |
| InChI: | InChI=1/C17H24N2O4/c1-11(2)9-14(18-12(3)20)16(21)19-15(17(22)23)10-13-7-5-4-6-8-13/h4-8,11,14-15H,9-10H2,1-3H3,(H,18,20)(H,19,21)(H,22,23)/p-1/t14-,15-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=60.8554 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 319.381 g/mol | logS: -3.58812 | SlogP: 0.01457 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.151568 | Sterimol/B1: 3.51196 | Sterimol/B2: 4.44871 | Sterimol/B3: 4.87959 | |||
| Sterimol/B4: 6.97306 | Sterimol/L: 13.8657 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 577.793 | Positive charged surface: 347.371 | Negative charged surface: 230.422 | Volume: 319 | |||
| Hydrophobic surface: 406.055 | Hydrophilic surface: 171.738 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
