 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C(=O)[O-])C)C(NC(=O)C([NH3+])CCCC[NH3+])C |
| InChI: | InChI=1/C12H24N4O4/c1-7(10(17)16-8(2)12(19)20)15-11(18)9(14)5-3-4-6-13/h7-9H,3-6,13-14H2,1-2H3,(H,15,18)(H,16,17)(H,19,20)/p+1/t7-,8+,9+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=53.8138 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 289.356 g/mol | logS: -0.78564 | SlogP: -4.2316 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0563107 | Sterimol/B1: 2.08841 | Sterimol/B2: 4.48941 | Sterimol/B3: 4.83324 | |||
| Sterimol/B4: 5.25908 | Sterimol/L: 18.2518 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 580.997 | Positive charged surface: 428.978 | Negative charged surface: 152.018 | Volume: 285.5 | |||
| Hydrophobic surface: 256.852 | Hydrophilic surface: 324.145 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 2 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
