Type: Ionized
Formula: C11H11NO6-2
SMILES: |
o1cccc1C(=O)NC(CCCC(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C11H13NO6/c13-9(14)5-1-3-7(11(16)17)12-10(15)8-4-2-6-18-8/h2,4,6-7H,1,3,5H2,(H,12,15)(H,13,14)(H,16,17)/p-2/t7-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 253.21 g/mol | logS: -2.08062 | SlogP: -1.9519 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0963821 | Sterimol/B1: 3.17613 | Sterimol/B2: 3.7262 | Sterimol/B3: 3.81757 |
Sterimol/B4: 6.91872 | Sterimol/L: 13.6849 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 460.72 | Positive charged surface: 214.681 | Negative charged surface: 246.039 | Volume: 219.75 |
Hydrophobic surface: 241.102 | Hydrophilic surface: 219.618 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 4 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|