Type: Neutral
Formula: C7H15NO8P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)CN1CCCC1C(O)=O |
InChI: |
InChI=1/C7H15NO8P2/c9-7(10)5-2-1-3-8(5)4-6(17(11,12)13)18(14,15)16/h5-6H,1-4H2,(H,9,10)(H2,11,12,13)(H2,14,15,16)/t5-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 303.144 g/mol | logS: 1.42166 | SlogP: -2.9235 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.268175 | Sterimol/B1: 2.64784 | Sterimol/B2: 3.3999 | Sterimol/B3: 4.05255 |
Sterimol/B4: 5.97409 | Sterimol/L: 10.9701 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 404.672 | Positive charged surface: 250.335 | Negative charged surface: 154.337 | Volume: 212.625 |
Hydrophobic surface: 179.384 | Hydrophilic surface: 225.288 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |