Type: Neutral
Formula: C12H16N2O4
SMILES: |
Oc1ccc(cc1)CC(NC(=O)C(N)C)C(O)=O |
InChI: |
InChI=1/C12H16N2O4/c1-7(13)11(16)14-10(12(17)18)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18)/t7-,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 252.27 g/mol | logS: -1.24494 | SlogP: -0.14873 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.142984 | Sterimol/B1: 2.725 | Sterimol/B2: 3.17365 | Sterimol/B3: 4.16951 |
Sterimol/B4: 7.24762 | Sterimol/L: 12.6517 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 475.332 | Positive charged surface: 297.757 | Negative charged surface: 177.574 | Volume: 235 |
Hydrophobic surface: 236.144 | Hydrophilic surface: 239.188 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |