Type: Neutral
Formula: C19H20N4O3
SMILES: |
O=C1N(CCCCC(=O)NCc2ncccc2)C(=O)Nc2c1cccc2 |
InChI: |
InChI=1/C19H20N4O3/c24-17(21-13-14-7-3-5-11-20-14)10-4-6-12-23-18(25)15-8-1-2-9-16(15)22-19(23)26/h1-3,5,7-9,11H,4,6,10,12-13H2,(H,21,24)(H,22,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 352.394 g/mol | logS: -2.95262 | SlogP: 2.8224 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0444093 | Sterimol/B1: 2.46075 | Sterimol/B2: 3.46976 | Sterimol/B3: 3.86364 |
Sterimol/B4: 6.30038 | Sterimol/L: 20.8527 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 640.411 | Positive charged surface: 418.472 | Negative charged surface: 221.938 | Volume: 333.75 |
Hydrophobic surface: 484.423 | Hydrophilic surface: 155.988 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |