Type: Neutral
Formula: C21H27N3OS
SMILES: |
S=C(N(CCc1ccncc1)C1CCCCC1)Nc1cc(OC)ccc1 |
InChI: |
InChI=1/C21H27N3OS/c1-25-20-9-5-6-18(16-20)23-21(26)24(19-7-3-2-4-8-19)15-12-17-10-13-22-14-11-17/h5-6,9-11,13-14,16,19H,2-4,7-8,12,15H2,1H3,(H,23,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 369.533 g/mol | logS: -4.86853 | SlogP: 4.66437 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0618026 | Sterimol/B1: 3.111 | Sterimol/B2: 4.36855 | Sterimol/B3: 4.44981 |
Sterimol/B4: 8.11232 | Sterimol/L: 18.4702 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 644.498 | Positive charged surface: 459.887 | Negative charged surface: 184.611 | Volume: 367.25 |
Hydrophobic surface: 579.26 | Hydrophilic surface: 65.238 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |