Type: Neutral
Formula: C16H17NO4
SMILES: |
O1C2C3C(C(C(C3)C2)C(=O)Nc2cc(ccc2O)C)C1=O |
InChI: |
InChI=1/C16H17NO4/c1-7-2-3-11(18)10(4-7)17-15(19)13-8-5-9-12(6-8)21-16(20)14(9)13/h2-4,8-9,12-14,18H,5-6H2,1H3,(H,17,19)/t8-,9+,12-,13-,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 287.315 g/mol | logS: -2.62279 | SlogP: 1.83672 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0732946 | Sterimol/B1: 2.17371 | Sterimol/B2: 3.3796 | Sterimol/B3: 3.7055 |
Sterimol/B4: 7.06058 | Sterimol/L: 14.1559 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 496.264 | Positive charged surface: 321.383 | Negative charged surface: 174.881 | Volume: 264.125 |
Hydrophobic surface: 357.18 | Hydrophilic surface: 139.084 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |