Type: Neutral
Formula: C16H17F3N4O4
SMILES: |
FC(F)(F)c1ccccc1NCC(=O)NC=1N(CCOC)C(=O)NC(=O)C=1 |
InChI: |
InChI=1/C16H17F3N4O4/c1-27-7-6-23-12(8-13(24)22-15(23)26)21-14(25)9-20-11-5-3-2-4-10(11)16(17,18)19/h2-5,8,20H,6-7,9H2,1H3,(H,21,25)(H,22,24,26) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 386.33 g/mol | logS: -3.62438 | SlogP: 1.5846 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0676959 | Sterimol/B1: 2.37058 | Sterimol/B2: 3.67968 | Sterimol/B3: 3.81362 |
Sterimol/B4: 8.38254 | Sterimol/L: 16.4992 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 613.105 | Positive charged surface: 350.138 | Negative charged surface: 262.968 | Volume: 316.875 |
Hydrophobic surface: 354.304 | Hydrophilic surface: 258.801 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |