Type: Neutral
Formula: C20H31N3O4
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(=O)NC1CC(N(O)C(C1)(C)C)(C)C)C |
InChI: |
InChI=1/C20H31N3O4/c1-14(21-18(25)27-13-15-9-7-6-8-10-15)17(24)22-16-11-19(2,3)23(26)20(4,5)12-16/h6-10,14,16,26H,11-13H2,1-5H3,(H,21,25)(H,22,24)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 377.485 g/mol | logS: -3.53916 | SlogP: 3.0947 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0510103 | Sterimol/B1: 1.98928 | Sterimol/B2: 3.5402 | Sterimol/B3: 4.28005 |
Sterimol/B4: 7.63094 | Sterimol/L: 19.8763 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 680.604 | Positive charged surface: 447.05 | Negative charged surface: 233.554 | Volume: 379 |
Hydrophobic surface: 477.849 | Hydrophilic surface: 202.755 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |