Type: Ionized
Formula: C8H13NO7S-2
| SMILES: |
S(=O)(=O)([O-])CC(NC(OC(C)(C)C)=O)C(=O)[O-] |
| InChI: |
InChI=1/C8H15NO7S/c1-8(2,3)16-7(12)9-5(6(10)11)4-17(13,14)15/h5H,4H2,1-3H3,(H,9,12)(H,10,11)(H,13,14,15)/p-2/t5-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 267.258 g/mol | logS: -1.16992 | SlogP: -1.8252 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.119478 | Sterimol/B1: 2.51704 | Sterimol/B2: 3.62541 | Sterimol/B3: 4.24 |
| Sterimol/B4: 5.21428 | Sterimol/L: 12.4246 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 449.879 | Positive charged surface: 212.053 | Negative charged surface: 237.826 | Volume: 211.375 |
| Hydrophobic surface: 189.436 | Hydrophilic surface: 260.443 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 5 | Basic groups: 0 |
| Chiral centers: 1 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|
