 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(=O)C(N)C(CC)C)C(=O)N |
| InChI: | InChI=1/C15H23N3O3/c1-3-9(2)13(16)15(21)18-12(14(17)20)8-10-4-6-11(19)7-5-10/h4-7,9,12-13,19H,3,8,16H2,1-2H3,(H2,17,20)(H,18,21)/t9-,12-,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=75.628 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 293.367 g/mol | logS: -2.44642 | SlogP: 0.27817 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.145815 | Sterimol/B1: 2.90506 | Sterimol/B2: 4.04835 | Sterimol/B3: 5.62188 | |||
| Sterimol/B4: 6.56327 | Sterimol/L: 12.5379 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 525.276 | Positive charged surface: 344.163 | Negative charged surface: 181.113 | Volume: 290.25 | |||
| Hydrophobic surface: 272.941 | Hydrophilic surface: 252.335 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
