Type: Neutral
Formula: C8H16N2O5
| SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1N |
| InChI: |
InChI=1/C8H16N2O5/c1-3(12)10-5-7(14)6(13)4(2-11)15-8(5)9/h4-8,11,13-14H,2,9H2,1H3,(H,10,12)/t4-,5-,6+,7-,8-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 220.225 g/mol | logS: 0.97358 | SlogP: -3.1112 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.0897719 | Sterimol/B1: 2.97613 | Sterimol/B2: 3.26016 | Sterimol/B3: 4.36702 |
| Sterimol/B4: 4.73992 | Sterimol/L: 12.8983 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 411.219 | Positive charged surface: 301.408 | Negative charged surface: 109.811 | Volume: 194.375 |
| Hydrophobic surface: 185.546 | Hydrophilic surface: 225.673 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 5 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |