Type: Neutral
Formula: C12H18N6O3
SMILES: |
O1C(CO)C(N(C)C)C(O)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C12H18N6O3/c1-17(2)8-6(3-19)21-12(9(8)20)18-5-16-7-10(13)14-4-15-11(7)18/h4-6,8-9,12,19-20H,3H2,1-2H3,(H2,13,14,15)/t6-,8+,9+,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.315 g/mol | logS: -1.06311 | SlogP: -1.3152 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.170742 | Sterimol/B1: 2.33729 | Sterimol/B2: 3.90881 | Sterimol/B3: 5.22755 |
Sterimol/B4: 5.7976 | Sterimol/L: 13.6298 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 497.483 | Positive charged surface: 419.111 | Negative charged surface: 78.3721 | Volume: 260.25 |
Hydrophobic surface: 256.843 | Hydrophilic surface: 240.64 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |