Type: Neutral
Formula: C6H11O8P
SMILES: |
P(O)(=O)(C(O)(C(O)=O)C)C(O)(C(O)=O)C |
InChI: |
InChI=1/C6H11O8P/c1-5(11,3(7)8)15(13,14)6(2,12)4(9)10/h11-12H,1-2H3,(H,7,8)(H,9,10)(H,13,14)/t5-,6+ |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 242.12 g/mol | logS: 0.63542 | SlogP: -2.2272 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.320119 | Sterimol/B1: 2.79551 | Sterimol/B2: 3.30421 | Sterimol/B3: 4.23209 |
Sterimol/B4: 5.14471 | Sterimol/L: 10.3617 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 371.733 | Positive charged surface: 193.044 | Negative charged surface: 178.689 | Volume: 181.625 |
Hydrophobic surface: 81.1508 | Hydrophilic surface: 290.5822 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|